C40H32O5 — CID 59372023
[4-(4-methylphenyl)phenyl] 4-[4-[[4-(4-methylphenyl)phenyl]methylperoxy]phenoxy]benzoate (PubChem CID 59372023) has the molecular formula C40H32O5 and a molecular weight of 592.69 g/mol. Its IUPAC name is [4-(4-methylphenyl)phenyl] 4-[4-[[4-(4-methylphenyl)phenyl]methylperoxy]phenoxy]benzoate.
| Compound Name | [4-(4-methylphenyl)phenyl] 4-[4-[[4-(4-methylphenyl)phenyl]methylperoxy]phenoxy]benzoate |
|---|---|
| PubChem CID | 59372023 |
| Molecular Formula | C40H32O5 |
| Molecular Weight | 592.69 g/mol |
| Exact Mass | 592.22 |
| IUPAC Name | [4-(4-methylphenyl)phenyl] 4-[4-[[4-(4-methylphenyl)phenyl]methylperoxy]phenoxy]benzoate |
| SMILES | Cc1ccc(-c2ccc(COOc3ccc(Oc4ccc(C(=O)Oc5ccc(-c6ccc(C)cc6)cc5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C40H32O5/c1-28-3-9-31(10-4-28)33-13-7-30(8-14-33)27-42-45-39-25-23-37(24-26-39)43-36-21-17-35(18-22-36)40(41)44-38-19-15-34(16-20-38)32-11-5-29(2)6-12-32/h3-26H,27H2,1-2H3 |
| InChIKey | ITQWSPADMHCXMJ-UHFFFAOYSA-N |
| XLogP | 10.16 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.69 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|