C22H24O8 — CID 20610677
[6-[(4-methoxyphenyl)methylperoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-methoxybenzoate (PubChem CID 20610677) has the molecular formula C22H24O8 and a molecular weight of 416.43 g/mol. Its IUPAC name is [6-[(4-methoxyphenyl)methylperoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-methoxybenzoate.
| Compound Name | [6-[(4-methoxyphenyl)methylperoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 20610677 |
| Molecular Formula | C22H24O8 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | [6-[(4-methoxyphenyl)methylperoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-methoxybenzoate |
| SMILES | COc1ccc(COOC2COC3C(OC(=O)c4ccc(OC)cc4)COC23)cc1 |
| InChI | InChI=1S/C22H24O8/c1-24-16-7-3-14(4-8-16)11-28-30-19-13-27-20-18(12-26-21(19)20)29-22(23)15-5-9-17(25-2)10-6-15/h3-10,18-21H,11-13H2,1-2H3 |
| InChIKey | KGHGTYOKZQIIDF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|