C26H26O10 — CID 59318800
[6-[4-(oxiran-2-ylmethoxy)benzoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-(oxiran-2-ylmethoxy)benzoate (PubChem CID 59318800) has the molecular formula C26H26O10 and a molecular weight of 498.48 g/mol. Its IUPAC name is [6-[4-(oxiran-2-ylmethoxy)benzoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-(oxiran-2-ylmethoxy)benzoate.
| Compound Name | [6-[4-(oxiran-2-ylmethoxy)benzoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-(oxiran-2-ylmethoxy)benzoate |
|---|---|
| PubChem CID | 59318800 |
| Molecular Formula | C26H26O10 |
| Molecular Weight | 498.48 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | [6-[4-(oxiran-2-ylmethoxy)benzoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-(oxiran-2-ylmethoxy)benzoate |
| SMILES | O=C(OC1COC2C(OC(=O)c3ccc(OCC4CO4)cc3)COC12)c1ccc(OCC2CO2)cc1 |
| InChI | InChI=1S/C26H26O10/c27-25(15-1-5-17(6-2-15)29-9-19-11-31-19)35-21-13-33-24-22(14-34-23(21)24)36-26(28)16-3-7-18(8-4-16)30-10-20-12-32-20/h1-8,19-24H,9-14H2 |
| InChIKey | DYMDQTIYYIMMDY-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 114.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.48 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|