C26H26O8 — CID 70212002
[(3R,3aR,6R,6aR)-6-(4-prop-2-enoxybenzoyl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-prop-2-enoxybenzoate (PubChem CID 70212002) has the molecular formula C26H26O8 and a molecular weight of 466.49 g/mol. Its IUPAC name is [(3R,3aR,6R,6aR)-6-(4-prop-2-enoxybenzoyl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-prop-2-enoxybenzoate.
| Compound Name | [(3R,3aR,6R,6aR)-6-(4-prop-2-enoxybenzoyl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-prop-2-enoxybenzoate |
|---|---|
| PubChem CID | 70212002 |
| Molecular Formula | C26H26O8 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | [(3R,3aR,6R,6aR)-6-(4-prop-2-enoxybenzoyl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-prop-2-enoxybenzoate |
| SMILES | C=CCOc1ccc(C(=O)O[C@@H]2CO[C@H]3[C@@H]2OC[C@H]3OC(=O)c2ccc(OCC=C)cc2)cc1 |
| InChI | InChI=1S/C26H26O8/c1-3-13-29-19-9-5-17(6-10-19)25(27)33-21-15-31-24-22(16-32-23(21)24)34-26(28)18-7-11-20(12-8-18)30-14-4-2/h3-12,21-24H,1-2,13-16H2/t21-,22-,23-,24-/m1/s1 |
| InChIKey | OXORFMOHEDJSOT-MOUTVQLLSA-N |
| XLogP | 3.36 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|