C34H27O10V- — CID 178054484
[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-benzoyloxybenzoate;4-(benzoyloxy)benzoic acid;vanadium (PubChem CID 178054484) has the molecular formula C34H27O10V- and a molecular weight of 646.52 g/mol. Its IUPAC name is [(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-benzoyloxybenzoate;4-(benzoyloxy)benzoic acid;vanadium.
| Compound Name | [(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-benzoyloxybenzoate;4-(benzoyloxy)benzoic acid;vanadium |
|---|---|
| PubChem CID | 178054484 |
| Molecular Formula | C34H27O10V- |
| Molecular Weight | 646.52 g/mol |
| Exact Mass | 646.10 |
| IUPAC Name | [(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-benzoyloxybenzoate;4-(benzoyloxy)benzoic acid;vanadium |
| SMILES | O=C(O)c1ccc(OC(=O)c2cc[c-]cc2)cc1.O=C(Oc1ccc(C(=O)OC2CO[C@@H]3CCO[C@H]23)cc1)c1ccccc1.[V] |
| InChI | InChI=1S/C20H18O6.C14H9O4.V/c21-19(13-4-2-1-3-5-13)25-15-8-6-14(7-9-15)20(22)26-17-12-24-16-10-11-23-18(16)17;15-13(16)10-6-8-12(9-7-10)18-14(17)11-4-2-1-3-5-11;/h1-9,16-18H,10-12H2;2-9H,(H,15,16);/q;-1;/t16-,17?,18+;;/m1../s1 |
| InChIKey | WRJATCHJFOHROR-XTEPDJILSA-N |
| XLogP | 5.02 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.52 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|