C36H34O10 — CID 145312732
[(6R)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 6-prop-2-enoyloxynaphthalene-2-carboxylate;ethane;6-prop-2-enoyloxynaphthalene-2-carboxylic acid (PubChem CID 145312732) has the molecular formula C36H34O10 and a molecular weight of 626.66 g/mol. Its IUPAC name is [(6R)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 6-prop-2-enoyloxynaphthalene-2-carboxylate;ethane;6-prop-2-enoyloxynaphthalene-2-carboxylic acid.
| Compound Name | [(6R)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 6-prop-2-enoyloxynaphthalene-2-carboxylate;ethane;6-prop-2-enoyloxynaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 145312732 |
| Molecular Formula | C36H34O10 |
| Molecular Weight | 626.66 g/mol |
| Exact Mass | 626.22 |
| IUPAC Name | [(6R)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 6-prop-2-enoyloxynaphthalene-2-carboxylate;ethane;6-prop-2-enoyloxynaphthalene-2-carboxylic acid |
| SMILES | C=CC(=O)Oc1ccc2cc(C(=O)O)ccc2c1.C=CC(=O)Oc1ccc2cc(C(=O)O[C@@H]3COC4CCOC43)ccc2c1.CC |
| InChI | InChI=1S/C20H18O6.C14H10O4.C2H6/c1-2-18(21)25-15-6-5-12-9-14(4-3-13(12)10-15)20(22)26-17-11-24-16-7-8-23-19(16)17;1-2-13(15)18-12-6-5-9-7-11(14(16)17)4-3-10(9)8-12;1-2/h2-6,9-10,16-17,19H,1,7-8,11H2;2-8H,1H2,(H,16,17);1-2H3/t16?,17-,19?;;/m1../s1 |
| InChIKey | NYMUQVDDNWJJJI-ZCLDIOMBSA-N |
| XLogP | 6.30 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.66 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|