C12H16O6 — CID 168912916
[(6R)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] prop-2-enoate;prop-2-enoic acid (PubChem CID 168912916) has the molecular formula C12H16O6 and a molecular weight of 256.25 g/mol. Its IUPAC name is [(6R)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] prop-2-enoate;prop-2-enoic acid.
| Compound Name | [(6R)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] prop-2-enoate;prop-2-enoic acid |
|---|---|
| PubChem CID | 168912916 |
| Molecular Formula | C12H16O6 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | [(6R)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] prop-2-enoate;prop-2-enoic acid |
| SMILES | C=CC(=O)O.C=CC(=O)O[C@@H]1COC2CCOC21 |
| InChI | InChI=1S/C9H12O4.C3H4O2/c1-2-8(10)13-7-5-12-6-3-4-11-9(6)7;1-2-3(4)5/h2,6-7,9H,1,3-5H2;2H,1H2,(H,4,5)/t6?,7-,9?;/m1./s1 |
| InChIKey | ZCYRJVNSSCOHNX-ODXGJKFXSA-N |
| XLogP | 0.53 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|