C10H17NO4 — CID 176676244
[(6R)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-aminobutanoate (PubChem CID 176676244) has the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. Its IUPAC name is [(6R)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-aminobutanoate.
| Compound Name | [(6R)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-aminobutanoate |
|---|---|
| PubChem CID | 176676244 |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | [(6R)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-aminobutanoate |
| SMILES | NCCCC(=O)O[C@@H]1COC2CCOC21 |
| InChI | InChI=1S/C10H17NO4/c11-4-1-2-9(12)15-8-6-14-7-3-5-13-10(7)8/h7-8,10H,1-6,11H2/t7?,8-,10?/m1/s1 |
| InChIKey | XQIPBTIRAGKTEJ-CCNFQMFXSA-N |
| XLogP | -0.18 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |