C9H19NO3 — CID 176698149
O-[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]hydroxylamine;propane (PubChem CID 176698149) has the molecular formula C9H19NO3 and a molecular weight of 189.25 g/mol. Its IUPAC name is O-[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]hydroxylamine;propane.
| Compound Name | O-[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]hydroxylamine;propane |
|---|---|
| PubChem CID | 176698149 |
| Molecular Formula | C9H19NO3 |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.14 |
| IUPAC Name | O-[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]hydroxylamine;propane |
| SMILES | CCC.NOC1CO[C@@H]2CCO[C@H]12 |
| InChI | InChI=1S/C6H11NO3.C3H8/c7-10-5-3-9-4-1-2-8-6(4)5;1-3-2/h4-6H,1-3,7H2;3H2,1-2H3/t4-,5?,6+;/m1./s1 |
| InChIKey | SGADTQGCKNMZMT-KQWAVXQLSA-N |
| XLogP | 0.85 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|