C10H12O6 — CID 144610402
(Z)-4-[[(6R)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-oxobut-2-enoic acid (PubChem CID 144610402) has the molecular formula C10H12O6 and a molecular weight of 228.20 g/mol. Its IUPAC name is (Z)-4-[[(6R)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-[[(6R)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 144610402 |
| Molecular Formula | C10H12O6 |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | (Z)-4-[[(6R)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C\C(=O)O[C@@H]1COC2CCOC21 |
| InChI | InChI=1S/C10H12O6/c11-8(12)1-2-9(13)16-7-5-15-6-3-4-14-10(6)7/h1-2,6-7,10H,3-5H2,(H,11,12)/b2-1-/t6?,7-,10?/m1/s1 |
| InChIKey | SWWUHASWZMSFBN-PIYPRDKDSA-N |
| XLogP | -0.27 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|