C14H16O10 — CID 90139102
4-[[(3R,3aR,6R,6aR)-6-[(Z)-3-carboxyprop-2-enoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-4-oxobutanoic acid (PubChem CID 90139102) has the molecular formula C14H16O10 and a molecular weight of 344.27 g/mol. Its IUPAC name is 4-[[(3R,3aR,6R,6aR)-6-[(Z)-3-carboxyprop-2-enoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-4-oxobutanoic acid.
| Compound Name | 4-[[(3R,3aR,6R,6aR)-6-[(Z)-3-carboxyprop-2-enoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 90139102 |
| Molecular Formula | C14H16O10 |
| Molecular Weight | 344.27 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 4-[[(3R,3aR,6R,6aR)-6-[(Z)-3-carboxyprop-2-enoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-4-oxobutanoic acid |
| SMILES | O=C(O)/C=C\C(=O)O[C@@H]1CO[C@H]2[C@@H]1OC[C@H]2OC(=O)CCC(=O)O |
| InChI | InChI=1S/C14H16O10/c15-9(16)1-3-11(19)23-7-5-21-14-8(6-22-13(7)14)24-12(20)4-2-10(17)18/h1,3,7-8,13-14H,2,4-6H2,(H,15,16)(H,17,18)/b3-1-/t7-,8-,13-,14-/m1/s1 |
| InChIKey | BGGIAPLBZZJGCR-VMDQLHSGSA-N |
| XLogP | -0.89 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.27 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|