C21H28O12 — CID 122693380
4-[[(3R,3aR,6S,6aR)-6-[4-[[(3S,3aR,6R,6aS)-3-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-oxobutanoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-4-oxobutanoic acid (PubChem CID 122693380) has the molecular formula C21H28O12 and a molecular weight of 472.44 g/mol. Its IUPAC name is 4-[[(3R,3aR,6S,6aR)-6-[4-[[(3S,3aR,6R,6aS)-3-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-oxobutanoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-4-oxobutanoic acid.
| Compound Name | 4-[[(3R,3aR,6S,6aR)-6-[4-[[(3S,3aR,6R,6aS)-3-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-oxobutanoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 122693380 |
| Molecular Formula | C21H28O12 |
| Molecular Weight | 472.44 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | 4-[[(3R,3aR,6S,6aR)-6-[4-[[(3S,3aR,6R,6aS)-3-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-oxobutanoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-4-oxobutanoic acid |
| SMILES | C[C@H]1CO[C@H]2[C@@H]1OC[C@H]2OC(=O)CCC(=O)O[C@H]1CO[C@H]2[C@@H]1OC[C@H]2OC(=O)CCC(=O)O |
| InChI | InChI=1S/C21H28O12/c1-10-6-27-19-11(7-28-18(10)19)31-16(25)4-5-17(26)33-13-9-30-20-12(8-29-21(13)20)32-15(24)3-2-14(22)23/h10-13,18-21H,2-9H2,1H3,(H,22,23)/t10-,11+,12+,13-,18+,19+,20+,21+/m0/s1 |
| InChIKey | WMMVAGAMABCKJM-ZZPBVAKOSA-N |
| XLogP | -0.40 |
| TPSA | 153.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.44 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|