C14H20O10 — CID 123273312
4-[[6-(3-carboxypropanoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-4-hydroxybutanoic acid (PubChem CID 123273312) has the molecular formula C14H20O10 and a molecular weight of 348.30 g/mol. Its IUPAC name is 4-[[6-(3-carboxypropanoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-4-hydroxybutanoic acid.
| Compound Name | 4-[[6-(3-carboxypropanoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 123273312 |
| Molecular Formula | C14H20O10 |
| Molecular Weight | 348.30 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 4-[[6-(3-carboxypropanoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-4-hydroxybutanoic acid |
| SMILES | O=C(O)CCC(=O)OC1COC2C(OC(O)CCC(=O)O)COC12 |
| InChI | InChI=1S/C14H20O10/c15-9(16)1-3-11(19)23-7-5-21-14-8(6-22-13(7)14)24-12(20)4-2-10(17)18/h7-8,11,13-14,19H,1-6H2,(H,15,16)(H,17,18) |
| InChIKey | AQUUVDADYQCQSL-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.30 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|