C12H15ClO7 — CID 144610416
[(3R,3aR,6R,6aR)-3-acetyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-chloro-4-oxobutanoate (PubChem CID 144610416) has the molecular formula C12H15ClO7 and a molecular weight of 306.70 g/mol. Its IUPAC name is [(3R,3aR,6R,6aR)-3-acetyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-chloro-4-oxobutanoate.
| Compound Name | [(3R,3aR,6R,6aR)-3-acetyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-chloro-4-oxobutanoate |
|---|---|
| PubChem CID | 144610416 |
| Molecular Formula | C12H15ClO7 |
| Molecular Weight | 306.70 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | [(3R,3aR,6R,6aR)-3-acetyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-chloro-4-oxobutanoate |
| SMILES | CC(=O)O[C@@H]1CO[C@H]2[C@@H]1OC[C@H]2OC(=O)CCC(=O)Cl |
| InChI | InChI=1S/C12H15ClO7/c1-6(14)19-7-4-17-12-8(5-18-11(7)12)20-10(16)3-2-9(13)15/h7-8,11-12H,2-5H2,1H3/t7-,8-,11-,12-/m1/s1 |
| InChIKey | YPRBZYRUGAGPMJ-GAJNKVMBSA-N |
| XLogP | 0.17 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.70 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|