C9H13NO6 — CID 118973915
[(3S,3aR,6R,6aR)-6-carbamoyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] acetate (PubChem CID 118973915) has the molecular formula C9H13NO6 and a molecular weight of 231.20 g/mol. Its IUPAC name is [(3S,3aR,6R,6aR)-6-carbamoyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] acetate.
| Compound Name | [(3S,3aR,6R,6aR)-6-carbamoyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] acetate |
|---|---|
| PubChem CID | 118973915 |
| Molecular Formula | C9H13NO6 |
| Molecular Weight | 231.20 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | [(3S,3aR,6R,6aR)-6-carbamoyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CO[C@H]2[C@@H]1OC[C@H]2OC(N)=O |
| InChI | InChI=1S/C9H13NO6/c1-4(11)15-5-2-13-8-6(16-9(10)12)3-14-7(5)8/h5-8H,2-3H2,1H3,(H2,10,12)/t5-,6+,7+,8+/m0/s1 |
| InChIKey | UOYCJLGIHWPJRR-LXGUWJNJSA-N |
| XLogP | -0.82 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.20 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |