C9H14O7 — CID 91848771
[(3S,4S,5R,6R)-5-acetyloxy-4,6-dihydroxyoxan-3-yl] acetate (PubChem CID 91848771) has the molecular formula C9H14O7 and a molecular weight of 234.20 g/mol. Its IUPAC name is [(3S,4S,5R,6R)-5-acetyloxy-4,6-dihydroxyoxan-3-yl] acetate.
| Compound Name | [(3S,4S,5R,6R)-5-acetyloxy-4,6-dihydroxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 91848771 |
| Molecular Formula | C9H14O7 |
| Molecular Weight | 234.20 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | [(3S,4S,5R,6R)-5-acetyloxy-4,6-dihydroxyoxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](O)[C@@H](OC(C)=O)CO[C@H]1O |
| InChI | InChI=1S/C9H14O7/c1-4(10)15-6-3-14-9(13)8(7(6)12)16-5(2)11/h6-9,12-13H,3H2,1-2H3/t6-,7-,8+,9+/m0/s1 |
| InChIKey | CDWHXEJTJJDLJF-RBXMUDONSA-N |
| XLogP | -1.44 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.20 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |