C16H23NO9 — CID 10785552
[(3S,4S,5S)-1-acetyl-4-acetyloxy-5-[(2R,3S,4S)-4-acetyloxy-3-hydroxyoxolan-2-yl]pyrrolidin-3-yl] acetate (PubChem CID 10785552) has the molecular formula C16H23NO9 and a molecular weight of 373.36 g/mol. Its IUPAC name is [(3S,4S,5S)-1-acetyl-4-acetyloxy-5-[(2R,3S,4S)-4-acetyloxy-3-hydroxyoxolan-2-yl]pyrrolidin-3-yl] acetate.
| Compound Name | [(3S,4S,5S)-1-acetyl-4-acetyloxy-5-[(2R,3S,4S)-4-acetyloxy-3-hydroxyoxolan-2-yl]pyrrolidin-3-yl] acetate |
|---|---|
| PubChem CID | 10785552 |
| Molecular Formula | C16H23NO9 |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | [(3S,4S,5S)-1-acetyl-4-acetyloxy-5-[(2R,3S,4S)-4-acetyloxy-3-hydroxyoxolan-2-yl]pyrrolidin-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H]([C@H]2OC[C@H](OC(C)=O)[C@H]2O)N(C(C)=O)C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C16H23NO9/c1-7(18)17-5-11(24-8(2)19)15(26-10(4)21)13(17)16-14(22)12(6-23-16)25-9(3)20/h11-16,22H,5-6H2,1-4H3/t11-,12-,13+,14+,15+,16+/m0/s1 |
| InChIKey | JORKNCYZOCRNDQ-KPRKPIBOSA-N |
| XLogP | -1.23 |
| TPSA | 128.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|