C9H13N3O6 — CID 132937524
[(3R,4S,5S)-3-acetyloxy-5-azido-2-hydroxyoxan-4-yl] acetate (PubChem CID 132937524) has the molecular formula C9H13N3O6 and a molecular weight of 259.22 g/mol. Its IUPAC name is [(3R,4S,5S)-3-acetyloxy-5-azido-2-hydroxyoxan-4-yl] acetate.
| Compound Name | [(3R,4S,5S)-3-acetyloxy-5-azido-2-hydroxyoxan-4-yl] acetate |
|---|---|
| PubChem CID | 132937524 |
| Molecular Formula | C9H13N3O6 |
| Molecular Weight | 259.22 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | [(3R,4S,5S)-3-acetyloxy-5-azido-2-hydroxyoxan-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H](N=[N+]=[N-])COC(O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C9H13N3O6/c1-4(13)17-7-6(11-12-10)3-16-9(15)8(7)18-5(2)14/h6-9,15H,3H2,1-2H3/t6-,7-,8+,9?/m0/s1 |
| InChIKey | SESRVIYODAAJBJ-VTBDLZGYSA-N |
| XLogP | -0.12 |
| TPSA | 130.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.22 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|