C11H15ClN6O5 — CID 102462538
[(1R,2S,3S,4R,6S)-2-acetyloxy-4,6-diazido-3-(chloromethoxy)cyclohexyl] acetate (PubChem CID 102462538) has the molecular formula C11H15ClN6O5 and a molecular weight of 346.73 g/mol. Its IUPAC name is [(1R,2S,3S,4R,6S)-2-acetyloxy-4,6-diazido-3-(chloromethoxy)cyclohexyl] acetate.
| Compound Name | [(1R,2S,3S,4R,6S)-2-acetyloxy-4,6-diazido-3-(chloromethoxy)cyclohexyl] acetate |
|---|---|
| PubChem CID | 102462538 |
| Molecular Formula | C11H15ClN6O5 |
| Molecular Weight | 346.73 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | [(1R,2S,3S,4R,6S)-2-acetyloxy-4,6-diazido-3-(chloromethoxy)cyclohexyl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OCCl)[C@H](N=[N+]=[N-])C[C@H](N=[N+]=[N-])[C@H]1OC(C)=O |
| InChI | InChI=1S/C11H15ClN6O5/c1-5(19)22-10-8(16-18-14)3-7(15-17-13)9(21-4-12)11(10)23-6(2)20/h7-11H,3-4H2,1-2H3/t7-,8+,9+,10-,11-/m1/s1 |
| InChIKey | LTPCLKPQYPZJMN-ZKKRXERASA-N |
| XLogP | 2.19 |
| TPSA | 159.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.73 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|