C8H12ClN3O3 — CID 177403737
[(2S,3S,4S,6R)-4-azido-6-chloro-2-methyloxan-3-yl] acetate (PubChem CID 177403737) has the molecular formula C8H12ClN3O3 and a molecular weight of 233.66 g/mol. Its IUPAC name is [(2S,3S,4S,6R)-4-azido-6-chloro-2-methyloxan-3-yl] acetate.
| Compound Name | [(2S,3S,4S,6R)-4-azido-6-chloro-2-methyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 177403737 |
| Molecular Formula | C8H12ClN3O3 |
| Molecular Weight | 233.66 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | [(2S,3S,4S,6R)-4-azido-6-chloro-2-methyloxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H](N=[N+]=[N-])C[C@@H](Cl)O[C@H]1C |
| InChI | InChI=1S/C8H12ClN3O3/c1-4-8(15-5(2)13)6(11-12-10)3-7(9)14-4/h4,6-8H,3H2,1-2H3/t4-,6-,7-,8+/m0/s1 |
| InChIKey | DHUBLAFSCCVMDI-YDLFOAGRSA-N |
| XLogP | 1.97 |
| TPSA | 84.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.66 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|