C10H14BrN3O5 — CID 139611925
[(2S,3R,4S,5S,6R)-4-acetyloxy-5-azido-6-bromo-2-methyloxan-3-yl] acetate (PubChem CID 139611925) has the molecular formula C10H14BrN3O5 and a molecular weight of 336.14 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6R)-4-acetyloxy-5-azido-6-bromo-2-methyloxan-3-yl] acetate.
| Compound Name | [(2S,3R,4S,5S,6R)-4-acetyloxy-5-azido-6-bromo-2-methyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 139611925 |
| Molecular Formula | C10H14BrN3O5 |
| Molecular Weight | 336.14 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | [(2S,3R,4S,5S,6R)-4-acetyloxy-5-azido-6-bromo-2-methyloxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](N=[N+]=[N-])[C@@H](Br)O[C@@H](C)[C@H]1OC(C)=O |
| InChI | InChI=1S/C10H14BrN3O5/c1-4-8(18-5(2)15)9(19-6(3)16)7(13-14-12)10(11)17-4/h4,7-10H,1-3H3/t4-,7-,8+,9-,10-/m0/s1 |
| InChIKey | MBFHZPXLJHKHNI-SGZWNVLDSA-N |
| XLogP | 1.67 |
| TPSA | 110.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.14 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|