C9H14N6O4 — CID 23249240
[(2R,3R,4S,5R,6S)-3,5-diazido-2-methoxy-6-methyloxan-4-yl] acetate (PubChem CID 23249240) has the molecular formula C9H14N6O4 and a molecular weight of 270.25 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,5-diazido-2-methoxy-6-methyloxan-4-yl] acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,5-diazido-2-methoxy-6-methyloxan-4-yl] acetate |
|---|---|
| PubChem CID | 23249240 |
| Molecular Formula | C9H14N6O4 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,5-diazido-2-methoxy-6-methyloxan-4-yl] acetate |
| SMILES | CO[C@@H]1O[C@@H](C)[C@@H](N=[N+]=[N-])[C@H](OC(C)=O)[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C9H14N6O4/c1-4-6(12-14-10)8(19-5(2)16)7(13-15-11)9(17-3)18-4/h4,6-9H,1-3H3/t4-,6+,7+,8-,9+/m0/s1 |
| InChIKey | RLYHZAXXSZTHHI-UQOMZCPUSA-N |
| XLogP | 1.67 |
| TPSA | 142.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|