C11H17N3O5 — CID 118933629
[(4S,5S)-2-acetyloxy-5-azido-4,6-dimethyloxan-3-yl] acetate (PubChem CID 118933629) has the molecular formula C11H17N3O5 and a molecular weight of 271.27 g/mol. Its IUPAC name is [(4S,5S)-2-acetyloxy-5-azido-4,6-dimethyloxan-3-yl] acetate.
| Compound Name | [(4S,5S)-2-acetyloxy-5-azido-4,6-dimethyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 118933629 |
| Molecular Formula | C11H17N3O5 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | [(4S,5S)-2-acetyloxy-5-azido-4,6-dimethyloxan-3-yl] acetate |
| SMILES | CC(=O)OC1OC(C)[C@@H](N=[N+]=[N-])[C@H](C)C1OC(C)=O |
| InChI | InChI=1S/C11H17N3O5/c1-5-9(13-14-12)6(2)17-11(19-8(4)16)10(5)18-7(3)15/h5-6,9-11H,1-4H3/t5-,6?,9-,10?,11?/m0/s1 |
| InChIKey | FEGOMTAPMSVUJY-ATKKYSHXSA-N |
| XLogP | 1.54 |
| TPSA | 110.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|