C11H20N4O4 — CID 45357382
[(3S,5S,6R)-5-amino-4-azido-2-methyl-6-propan-2-yloxyoxan-3-yl] acetate (PubChem CID 45357382) has the molecular formula C11H20N4O4 and a molecular weight of 272.31 g/mol. Its IUPAC name is [(3S,5S,6R)-5-amino-4-azido-2-methyl-6-propan-2-yloxyoxan-3-yl] acetate.
| Compound Name | [(3S,5S,6R)-5-amino-4-azido-2-methyl-6-propan-2-yloxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 45357382 |
| Molecular Formula | C11H20N4O4 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | [(3S,5S,6R)-5-amino-4-azido-2-methyl-6-propan-2-yloxyoxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C(C)O[C@@H](OC(C)C)[C@@H](N)C1N=[N+]=[N-] |
| InChI | InChI=1S/C11H20N4O4/c1-5(2)17-11-8(12)9(14-15-13)10(6(3)18-11)19-7(4)16/h5-6,8-11H,12H2,1-4H3/t6?,8-,9?,10+,11+/m0/s1 |
| InChIKey | ZYZVKUIZFNVVOQ-SEKIMFTDSA-N |
| XLogP | 1.09 |
| TPSA | 119.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|