C14H17N3O5S — CID 101163260
[(2R,3S,4R,5S)-4-azido-6-(benzenesulfinyl)-5-hydroxy-2-methyloxan-3-yl] acetate (PubChem CID 101163260) has the molecular formula C14H17N3O5S and a molecular weight of 339.37 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-4-azido-6-(benzenesulfinyl)-5-hydroxy-2-methyloxan-3-yl] acetate.
| Compound Name | [(2R,3S,4R,5S)-4-azido-6-(benzenesulfinyl)-5-hydroxy-2-methyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 101163260 |
| Molecular Formula | C14H17N3O5S |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | [(2R,3S,4R,5S)-4-azido-6-(benzenesulfinyl)-5-hydroxy-2-methyloxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](N=[N+]=[N-])[C@H](O)C(S(=O)c2ccccc2)O[C@@H]1C |
| InChI | InChI=1S/C14H17N3O5S/c1-8-13(22-9(2)18)11(16-17-15)12(19)14(21-8)23(20)10-6-4-3-5-7-10/h3-8,11-14,19H,1-2H3/t8-,11-,12+,13-,14?,23?/m1/s1 |
| InChIKey | JHBBPSWQUJNRNR-YBYZIQHUSA-N |
| XLogP | 1.51 |
| TPSA | 121.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|