C17H21N3O5S — CID 54426439
[(2R,3S,4S,5R,6R)-3-acetyloxy-5-azido-2-ethylsulfanyl-6-methyloxan-4-yl] benzoate (PubChem CID 54426439) has the molecular formula C17H21N3O5S and a molecular weight of 379.44 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3-acetyloxy-5-azido-2-ethylsulfanyl-6-methyloxan-4-yl] benzoate.
| Compound Name | [(2R,3S,4S,5R,6R)-3-acetyloxy-5-azido-2-ethylsulfanyl-6-methyloxan-4-yl] benzoate |
|---|---|
| PubChem CID | 54426439 |
| Molecular Formula | C17H21N3O5S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3-acetyloxy-5-azido-2-ethylsulfanyl-6-methyloxan-4-yl] benzoate |
| SMILES | CCS[C@H]1O[C@H](C)[C@@H](N=[N+]=[N-])[C@H](OC(=O)c2ccccc2)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C17H21N3O5S/c1-4-26-17-15(24-11(3)21)14(13(19-20-18)10(2)23-17)25-16(22)12-8-6-5-7-9-12/h5-10,13-15,17H,4H2,1-3H3/t10-,13-,14+,15+,17-/m1/s1 |
| InChIKey | WEKPFJDWOOFTRA-LRJGVJIGSA-N |
| XLogP | 3.32 |
| TPSA | 110.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|