C21H31N3O6Si — CID 134971157
[(3R,4R,5S,6R)-2-acetyloxy-4-azido-5-[tert-butyl(dimethyl)silyl]oxy-6-methyloxan-3-yl] benzoate (PubChem CID 134971157) has the molecular formula C21H31N3O6Si and a molecular weight of 449.58 g/mol. Its IUPAC name is [(3R,4R,5S,6R)-2-acetyloxy-4-azido-5-[tert-butyl(dimethyl)silyl]oxy-6-methyloxan-3-yl] benzoate.
| Compound Name | [(3R,4R,5S,6R)-2-acetyloxy-4-azido-5-[tert-butyl(dimethyl)silyl]oxy-6-methyloxan-3-yl] benzoate |
|---|---|
| PubChem CID | 134971157 |
| Molecular Formula | C21H31N3O6Si |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | [(3R,4R,5S,6R)-2-acetyloxy-4-azido-5-[tert-butyl(dimethyl)silyl]oxy-6-methyloxan-3-yl] benzoate |
| SMILES | CC(=O)OC1O[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N=[N+]=[N-])[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H31N3O6Si/c1-13-17(30-31(6,7)21(3,4)5)16(23-24-22)18(20(27-13)28-14(2)25)29-19(26)15-11-9-8-10-12-15/h8-13,16-18,20H,1-7H3/t13-,16+,17-,18-,20?/m1/s1 |
| InChIKey | FJKOPWYTAVHEHA-DBKPMNDOSA-N |
| XLogP | 4.59 |
| TPSA | 119.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|