C16H27Cl3N4O5Si — CID 14081765
[(2R,3R,4R,5S,6R)-4-azido-5-[tert-butyl(dimethyl)silyl]oxy-6-methyl-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate (PubChem CID 14081765) has the molecular formula C16H27Cl3N4O5Si and a molecular weight of 489.86 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6R)-4-azido-5-[tert-butyl(dimethyl)silyl]oxy-6-methyl-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate.
| Compound Name | [(2R,3R,4R,5S,6R)-4-azido-5-[tert-butyl(dimethyl)silyl]oxy-6-methyl-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 14081765 |
| Molecular Formula | C16H27Cl3N4O5Si |
| Molecular Weight | 489.86 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | [(2R,3R,4R,5S,6R)-4-azido-5-[tert-butyl(dimethyl)silyl]oxy-6-methyl-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate |
| SMILES | [H]/N=C(/O[C@H]1O[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N=[N+]=[N-])[C@H]1OC(C)=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H27Cl3N4O5Si/c1-8-11(28-29(6,7)15(3,4)5)10(22-23-21)12(26-9(2)24)13(25-8)27-14(20)16(17,18)19/h8,10-13,20H,1-7H3/b20-14+/t8-,10+,11-,12-,13-/m1/s1 |
| InChIKey | XRXRKRZLDOAYJT-JCSRIMDOSA-N |
| XLogP | 5.10 |
| TPSA | 126.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.86 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|