C18H29BrCl3NO7Si — CID 10962965
[(2R,3R,4S,5R,6R)-4-acetyloxy-5-bromo-3-[tert-butyl(dimethyl)silyl]oxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate (PubChem CID 10962965) has the molecular formula C18H29BrCl3NO7Si and a molecular weight of 585.78 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-4-acetyloxy-5-bromo-3-[tert-butyl(dimethyl)silyl]oxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-4-acetyloxy-5-bromo-3-[tert-butyl(dimethyl)silyl]oxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10962965 |
| Molecular Formula | C18H29BrCl3NO7Si |
| Molecular Weight | 585.78 g/mol |
| Exact Mass | 583.00 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-4-acetyloxy-5-bromo-3-[tert-butyl(dimethyl)silyl]oxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
| SMILES | [H]/N=C(/O[C@H]1O[C@H](COC(C)=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](OC(C)=O)[C@H]1Br)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C18H29BrCl3NO7Si/c1-9(24)26-8-11-13(30-31(6,7)17(3,4)5)14(27-10(2)25)12(19)15(28-11)29-16(23)18(20,21)22/h11-15,23H,8H2,1-7H3/b23-16+/t11-,12-,13-,14-,15-/m1/s1 |
| InChIKey | OAUAHOVVSFCQIC-WMJLTLEKSA-N |
| XLogP | 4.72 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.78 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|