C14H19Cl3N2O6 — CID 163733203
[3-acetyloxy-4-methyl-5-(methylideneamino)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate (PubChem CID 163733203) has the molecular formula C14H19Cl3N2O6 and a molecular weight of 417.67 g/mol. Its IUPAC name is [3-acetyloxy-4-methyl-5-(methylideneamino)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate.
| Compound Name | [3-acetyloxy-4-methyl-5-(methylideneamino)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 163733203 |
| Molecular Formula | C14H19Cl3N2O6 |
| Molecular Weight | 417.67 g/mol |
| Exact Mass | 416.03 |
| IUPAC Name | [3-acetyloxy-4-methyl-5-(methylideneamino)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
| SMILES | [H]/N=C(/OC1OC(COC(C)=O)C(OC(C)=O)C(C)C1N=C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H19Cl3N2O6/c1-6-10(19-4)12(25-13(18)14(15,16)17)24-9(5-22-7(2)20)11(6)23-8(3)21/h6,9-12,18H,4-5H2,1-3H3/b18-13+ |
| InChIKey | LBJLUHZZRXVOCM-QGOAFFKASA-N |
| XLogP | 2.28 |
| TPSA | 107.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.67 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|