C14H17Cl3FNO8 — CID 118005600
[(2R,3R,4S,5R)-3,4-diacetyloxy-5-fluoro-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate (PubChem CID 118005600) has the molecular formula C14H17Cl3FNO8 and a molecular weight of 452.65 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3,4-diacetyloxy-5-fluoro-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R)-3,4-diacetyloxy-5-fluoro-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 118005600 |
| Molecular Formula | C14H17Cl3FNO8 |
| Molecular Weight | 452.65 g/mol |
| Exact Mass | 451.00 |
| IUPAC Name | [(2R,3R,4S,5R)-3,4-diacetyloxy-5-fluoro-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
| SMILES | [H]/N=C(/OC1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1F)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H17Cl3FNO8/c1-5(20)23-4-8-10(24-6(2)21)11(25-7(3)22)9(18)12(26-8)27-13(19)14(15,16)17/h8-12,19H,4H2,1-3H3/b19-13+/t8-,9-,10-,11-,12?/m1/s1 |
| InChIKey | OXPFDZLXFWZLTN-VWWFGCHTSA-N |
| XLogP | 1.84 |
| TPSA | 121.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.65 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|