C14H20Cl3NO6 — CID 158289100
[(3S,4S,6S)-5-acetyloxy-3,4-dimethyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate (PubChem CID 158289100) has the molecular formula C14H20Cl3NO6 and a molecular weight of 404.67 g/mol. Its IUPAC name is [(3S,4S,6S)-5-acetyloxy-3,4-dimethyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate.
| Compound Name | [(3S,4S,6S)-5-acetyloxy-3,4-dimethyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 158289100 |
| Molecular Formula | C14H20Cl3NO6 |
| Molecular Weight | 404.67 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | [(3S,4S,6S)-5-acetyloxy-3,4-dimethyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
| SMILES | [H]/N=C(/O[C@@H]1OC(COC(C)=O)[C@@H](C)[C@H](C)C1OC(C)=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H20Cl3NO6/c1-6-7(2)11(22-9(4)20)12(24-13(18)14(15,16)17)23-10(6)5-21-8(3)19/h6-7,10-12,18H,5H2,1-4H3/b18-13+/t6-,7-,10?,11?,12-/m0/s1 |
| InChIKey | XVICVPVOXOIUDN-SYGNTJBNSA-N |
| XLogP | 2.84 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.67 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|