C26H36Cl3NO14 — CID 89115405
[(2S,3S,6R)-5-acetyloxy-3-[(2R,4S,5R)-3,5-diacetyloxy-6-(acetyloxymethyl)-4-methyloxan-2-yl]oxy-4-methyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate (PubChem CID 89115405) has the molecular formula C26H36Cl3NO14 and a molecular weight of 692.93 g/mol. Its IUPAC name is [(2S,3S,6R)-5-acetyloxy-3-[(2R,4S,5R)-3,5-diacetyloxy-6-(acetyloxymethyl)-4-methyloxan-2-yl]oxy-4-methyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2S,3S,6R)-5-acetyloxy-3-[(2R,4S,5R)-3,5-diacetyloxy-6-(acetyloxymethyl)-4-methyloxan-2-yl]oxy-4-methyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 89115405 |
| Molecular Formula | C26H36Cl3NO14 |
| Molecular Weight | 692.93 g/mol |
| Exact Mass | 691.12 |
| IUPAC Name | [(2S,3S,6R)-5-acetyloxy-3-[(2R,4S,5R)-3,5-diacetyloxy-6-(acetyloxymethyl)-4-methyloxan-2-yl]oxy-4-methyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
| SMILES | [H]/N=C(/O[C@H]1O[C@@H](COC(C)=O)[C@@H](O[C@@H]2OC(COC(C)=O)[C@H](OC(C)=O)[C@H](C)C2OC(C)=O)C(C)C1OC(C)=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C26H36Cl3NO14/c1-10-19(38-14(5)33)17(8-36-12(3)31)41-23(21(10)39-15(6)34)43-20-11(2)22(40-16(7)35)24(44-25(30)26(27,28)29)42-18(20)9-37-13(4)32/h10-11,17-24,30H,8-9H2,1-7H3/b30-25+/t10-,11?,17?,18-,19+,20-,21?,22?,23-,24+/m0/s1 |
| InChIKey | UKPQOXHCSQFIKR-RFZJMSFNSA-N |
| XLogP | 2.38 |
| TPSA | 192.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.93 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|