C16H20Cl3NO10 — CID 154717708
[(2R,6S)-3,4,5-triacetyloxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate (PubChem CID 154717708) has the molecular formula C16H20Cl3NO10 and a molecular weight of 492.69 g/mol. Its IUPAC name is [(2R,6S)-3,4,5-triacetyloxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,6S)-3,4,5-triacetyloxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 154717708 |
| Molecular Formula | C16H20Cl3NO10 |
| Molecular Weight | 492.69 g/mol |
| Exact Mass | 491.02 |
| IUPAC Name | [(2R,6S)-3,4,5-triacetyloxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
| SMILES | [H]/N=C(/O[C@@H]1O[C@H](COC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H20Cl3NO10/c1-6(21)25-5-10-11(26-7(2)22)12(27-8(3)23)13(28-9(4)24)14(29-10)30-15(20)16(17,18)19/h10-14,20H,5H2,1-4H3/b20-15+/t10-,11?,12?,13?,14+/m1/s1 |
| InChIKey | IBUZGVQIKARDAF-CQIOQZSISA-N |
| XLogP | 1.43 |
| TPSA | 147.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.69 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|