C14H17Cl4NO8 — CID 67729122
[(2S,3S,4S,5R)-4,5-diacetyloxy-2-(chloromethyl)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate (PubChem CID 67729122) has the molecular formula C14H17Cl4NO8 and a molecular weight of 469.10 g/mol. Its IUPAC name is [(2S,3S,4S,5R)-4,5-diacetyloxy-2-(chloromethyl)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate.
| Compound Name | [(2S,3S,4S,5R)-4,5-diacetyloxy-2-(chloromethyl)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 67729122 |
| Molecular Formula | C14H17Cl4NO8 |
| Molecular Weight | 469.10 g/mol |
| Exact Mass | 466.97 |
| IUPAC Name | [(2S,3S,4S,5R)-4,5-diacetyloxy-2-(chloromethyl)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate |
| SMILES | [H]/N=C(/OC1O[C@H](CCl)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H17Cl4NO8/c1-5(20)23-9-8(4-15)26-12(27-13(19)14(16,17)18)11(25-7(3)22)10(9)24-6(2)21/h8-12,19H,4H2,1-3H3/b19-13+/t8-,9-,10+,11-,12?/m1/s1 |
| InChIKey | AENFDCLPGGWJNW-XEBJUDNASA-N |
| XLogP | 2.11 |
| TPSA | 121.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.10 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|