C23H36Cl3NO8 — CID 58473199
[(2R,4S,5R)-2-[[(3R,4S,6S)-5-acetyloxy-3,4-dimethyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methoxy]-6-ethyl-4,5-dimethyloxan-3-yl] acetate (PubChem CID 58473199) has the molecular formula C23H36Cl3NO8 and a molecular weight of 560.90 g/mol. Its IUPAC name is [(2R,4S,5R)-2-[[(3R,4S,6S)-5-acetyloxy-3,4-dimethyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methoxy]-6-ethyl-4,5-dimethyloxan-3-yl] acetate.
| Compound Name | [(2R,4S,5R)-2-[[(3R,4S,6S)-5-acetyloxy-3,4-dimethyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methoxy]-6-ethyl-4,5-dimethyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 58473199 |
| Molecular Formula | C23H36Cl3NO8 |
| Molecular Weight | 560.90 g/mol |
| Exact Mass | 559.15 |
| IUPAC Name | [(2R,4S,5R)-2-[[(3R,4S,6S)-5-acetyloxy-3,4-dimethyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methoxy]-6-ethyl-4,5-dimethyloxan-3-yl] acetate |
| SMILES | [H]/N=C(/O[C@@H]1OC(CO[C@@H]2OC(CC)[C@H](C)[C@H](C)C2OC(C)=O)[C@H](C)[C@H](C)C1OC(C)=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C23H36Cl3NO8/c1-8-16-10(2)12(4)18(31-14(6)28)20(33-16)30-9-17-11(3)13(5)19(32-15(7)29)21(34-17)35-22(27)23(24,25)26/h10-13,16-21,27H,8-9H2,1-7H3/b27-22+/t10-,11-,12+,13+,16?,17?,18?,19?,20-,21+/m1/s1 |
| InChIKey | VCMBUJVPJDYYMF-HCXUEYTESA-N |
| XLogP | 4.63 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.90 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|