C12H20Cl3NO2 — CID 54059083
(6-ethyl-3,4,5-trimethyloxan-2-yl) 2,2,2-trichloroethanimidate (PubChem CID 54059083) has the molecular formula C12H20Cl3NO2 and a molecular weight of 316.66 g/mol. Its IUPAC name is (6-ethyl-3,4,5-trimethyloxan-2-yl) 2,2,2-trichloroethanimidate.
| Compound Name | (6-ethyl-3,4,5-trimethyloxan-2-yl) 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 54059083 |
| Molecular Formula | C12H20Cl3NO2 |
| Molecular Weight | 316.66 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | (6-ethyl-3,4,5-trimethyloxan-2-yl) 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OC1OC(CC)C(C)C(C)C1C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H20Cl3NO2/c1-5-9-7(3)6(2)8(4)10(17-9)18-11(16)12(13,14)15/h6-10,16H,5H2,1-4H3/b16-11+ |
| InChIKey | LYIZVFTUDQHOFF-LFIBNONCSA-N |
| XLogP | 4.39 |
| TPSA | 42.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.66 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|