C9H14Cl3NO6 — CID 91098146
[(3R,4S,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-methoxyoxan-2-yl] 2,2,2-trichloroethanimidate (PubChem CID 91098146) has the molecular formula C9H14Cl3NO6 and a molecular weight of 338.57 g/mol. Its IUPAC name is [(3R,4S,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-methoxyoxan-2-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [(3R,4S,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-methoxyoxan-2-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 91098146 |
| Molecular Formula | C9H14Cl3NO6 |
| Molecular Weight | 338.57 g/mol |
| Exact Mass | 336.99 |
| IUPAC Name | [(3R,4S,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-methoxyoxan-2-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OC1O[C@H](CO)[C@@H](O)[C@H](OC)[C@H]1O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H14Cl3NO6/c1-17-6-4(15)3(2-14)18-7(5(6)16)19-8(13)9(10,11)12/h3-7,13-16H,2H2,1H3/b13-8+/t3-,4-,5-,6+,7?/m1/s1 |
| InChIKey | VEYSFIUUPVWHJS-BDHOOOQLSA-N |
| XLogP | -0.20 |
| TPSA | 112.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.57 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|