C8H12Cl3NO5 — CID 18657656
[(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl] 2,2,2-trichloroethanimidate (PubChem CID 18657656) has the molecular formula C8H12Cl3NO5 and a molecular weight of 308.55 g/mol. Its IUPAC name is [(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 18657656 |
| Molecular Formula | C8H12Cl3NO5 |
| Molecular Weight | 308.55 g/mol |
| Exact Mass | 306.98 |
| IUPAC Name | [(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/O[C@@H]1O[C@@H](C)[C@@H](O)[C@@H](O)[C@@H]1O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H12Cl3NO5/c1-2-3(13)4(14)5(15)6(16-2)17-7(12)8(9,10)11/h2-6,12-15H,1H3/b12-7+/t2-,3+,4+,5-,6-/m0/s1 |
| InChIKey | PWNPKMLUCPRSBG-QAFHDOCZSA-N |
| XLogP | 0.18 |
| TPSA | 103.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.55 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|