C6H8Cl3NO2 — CID 10561589
[(2R,3S)-3-methyloxiran-2-yl]methyl 2,2,2-trichloroethanimidate (PubChem CID 10561589) has the molecular formula C6H8Cl3NO2 and a molecular weight of 232.49 g/mol. Its IUPAC name is [(2R,3S)-3-methyloxiran-2-yl]methyl 2,2,2-trichloroethanimidate.
| Compound Name | [(2R,3S)-3-methyloxiran-2-yl]methyl 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 10561589 |
| Molecular Formula | C6H8Cl3NO2 |
| Molecular Weight | 232.49 g/mol |
| Exact Mass | 230.96 |
| IUPAC Name | [(2R,3S)-3-methyloxiran-2-yl]methyl 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OC[C@H]1O[C@H]1C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C6H8Cl3NO2/c1-3-4(12-3)2-11-5(10)6(7,8)9/h3-4,10H,2H2,1H3/b10-5+/t3-,4+/m0/s1 |
| InChIKey | WQXOEKFDDLLBCA-BCHORNNYSA-N |
| XLogP | 2.14 |
| TPSA | 45.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.49 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|