C20H26Cl3I2NO10 — CID 11388715
[(2R,3R,4S,5R,6S)-4-[(2S,3R,4S,5R,6R)-4,5-diacetyloxy-3-iodo-6-methyloxan-2-yl]oxy-5-iodo-2-methyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate (PubChem CID 11388715) has the molecular formula C20H26Cl3I2NO10 and a molecular weight of 800.59 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-4-[(2S,3R,4S,5R,6R)-4,5-diacetyloxy-3-iodo-6-methyloxan-2-yl]oxy-5-iodo-2-methyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-4-[(2S,3R,4S,5R,6R)-4,5-diacetyloxy-3-iodo-6-methyloxan-2-yl]oxy-5-iodo-2-methyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 11388715 |
| Molecular Formula | C20H26Cl3I2NO10 |
| Molecular Weight | 800.59 g/mol |
| Exact Mass | 798.87 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-4-[(2S,3R,4S,5R,6R)-4,5-diacetyloxy-3-iodo-6-methyloxan-2-yl]oxy-5-iodo-2-methyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate |
| SMILES | [H]/N=C(/O[C@@H]1O[C@H](C)[C@@H](OC(C)=O)[C@H](O[C@@H]2O[C@H](C)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2I)[C@H]1I)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C20H26Cl3I2NO10/c1-6-13(32-8(3)27)15(34-10(5)29)11(24)17(30-6)35-16-12(25)18(36-19(26)20(21,22)23)31-7(2)14(16)33-9(4)28/h6-7,11-18,26H,1-5H3/b26-19+/t6-,7-,11-,12-,13-,14-,15-,16-,17+,18+/m1/s1 |
| InChIKey | YFIOAROIYKXMIZ-LIUISNRGSA-N |
| XLogP | 3.63 |
| TPSA | 139.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.59 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|