C14H19Cl3N4O7 — CID 12994833
[(2R,3R,4S,5R,6R)-5-acetyloxy-4-(2-azidoethoxy)-2-methyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate (PubChem CID 12994833) has the molecular formula C14H19Cl3N4O7 and a molecular weight of 461.69 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-5-acetyloxy-4-(2-azidoethoxy)-2-methyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-5-acetyloxy-4-(2-azidoethoxy)-2-methyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 12994833 |
| Molecular Formula | C14H19Cl3N4O7 |
| Molecular Weight | 461.69 g/mol |
| Exact Mass | 460.03 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-5-acetyloxy-4-(2-azidoethoxy)-2-methyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate |
| SMILES | [H]/N=C(/O[C@H]1O[C@H](C)[C@@H](OC(C)=O)[C@H](OCCN=[N+]=[N-])[C@H]1OC(C)=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H19Cl3N4O7/c1-6-9(26-7(2)22)10(24-5-4-20-21-19)11(27-8(3)23)12(25-6)28-13(18)14(15,16)17/h6,9-12,18H,4-5H2,1-3H3/b18-13+/t6-,9-,10+,11-,12-/m1/s1 |
| InChIKey | JGMSUZIKFGOTMJ-IKKNDYMISA-N |
| XLogP | 2.65 |
| TPSA | 152.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.69 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|