C16H22Cl3NO9 — CID 101235988
2-[(2R,3R,4S,5R,6R)-3,5-diacetyloxy-2-methyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-4-yl]oxyethyl acetate (PubChem CID 101235988) has the molecular formula C16H22Cl3NO9 and a molecular weight of 478.71 g/mol. Its IUPAC name is 2-[(2R,3R,4S,5R,6R)-3,5-diacetyloxy-2-methyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-4-yl]oxyethyl acetate.
| Compound Name | 2-[(2R,3R,4S,5R,6R)-3,5-diacetyloxy-2-methyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-4-yl]oxyethyl acetate |
|---|---|
| PubChem CID | 101235988 |
| Molecular Formula | C16H22Cl3NO9 |
| Molecular Weight | 478.71 g/mol |
| Exact Mass | 477.04 |
| IUPAC Name | 2-[(2R,3R,4S,5R,6R)-3,5-diacetyloxy-2-methyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-4-yl]oxyethyl acetate |
| SMILES | [H]/N=C(/O[C@H]1O[C@H](C)[C@@H](OC(C)=O)[C@H](OCCOC(C)=O)[C@H]1OC(C)=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H22Cl3NO9/c1-7-11(27-9(3)22)12(25-6-5-24-8(2)21)13(28-10(4)23)14(26-7)29-15(20)16(17,18)19/h7,11-14,20H,5-6H2,1-4H3/b20-15+/t7-,11-,12+,13-,14-/m1/s1 |
| InChIKey | ZQKVRVGKCVLOLT-AOIKOWTPSA-N |
| XLogP | 1.91 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.71 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|