C20H24Cl3NO6 — CID 10906967
[(2R,3R,4S,5R,6R)-6-methyl-5-phenylmethoxy-4-prop-2-enoxy-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate (PubChem CID 10906967) has the molecular formula C20H24Cl3NO6 and a molecular weight of 480.77 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-6-methyl-5-phenylmethoxy-4-prop-2-enoxy-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-6-methyl-5-phenylmethoxy-4-prop-2-enoxy-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 10906967 |
| Molecular Formula | C20H24Cl3NO6 |
| Molecular Weight | 480.77 g/mol |
| Exact Mass | 479.07 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-6-methyl-5-phenylmethoxy-4-prop-2-enoxy-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate |
| SMILES | [H]/N=C(/O[C@H]1O[C@H](C)[C@@H](OCc2ccccc2)[C@H](OCC=C)[C@H]1OC(C)=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C20H24Cl3NO6/c1-4-10-26-16-15(27-11-14-8-6-5-7-9-14)12(2)28-18(17(16)29-13(3)25)30-19(24)20(21,22)23/h4-9,12,15-18,24H,1,10-11H2,2-3H3/b24-19+/t12-,15-,16+,17-,18-/m1/s1 |
| InChIKey | VHNYKGCIDYOBEG-RQTUXSSSSA-N |
| XLogP | 4.18 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.77 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|