C31H40Cl3NO6 — CID 157473620
[5,6-dimethyl-3-phenylmethoxy-4-(4,5,6-trimethyl-3-phenylmethoxyoxan-2-yl)oxyoxan-2-yl] 2,2,2-trichloroethanimidate (PubChem CID 157473620) has the molecular formula C31H40Cl3NO6 and a molecular weight of 629.02 g/mol. Its IUPAC name is [5,6-dimethyl-3-phenylmethoxy-4-(4,5,6-trimethyl-3-phenylmethoxyoxan-2-yl)oxyoxan-2-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [5,6-dimethyl-3-phenylmethoxy-4-(4,5,6-trimethyl-3-phenylmethoxyoxan-2-yl)oxyoxan-2-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 157473620 |
| Molecular Formula | C31H40Cl3NO6 |
| Molecular Weight | 629.02 g/mol |
| Exact Mass | 627.19 |
| IUPAC Name | [5,6-dimethyl-3-phenylmethoxy-4-(4,5,6-trimethyl-3-phenylmethoxyoxan-2-yl)oxyoxan-2-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OC1OC(C)C(C)C(OC2OC(C)C(C)C(C)C2OCc2ccccc2)C1OCc1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C31H40Cl3NO6/c1-18-19(2)26(36-16-23-12-8-6-9-13-23)28(38-21(18)4)40-25-20(3)22(5)39-29(41-30(35)31(32,33)34)27(25)37-17-24-14-10-7-11-15-24/h6-15,18-22,25-29,35H,16-17H2,1-5H3/b35-30+ |
| InChIKey | HRDXECMBHUBOGJ-WUZYOQQESA-N |
| XLogP | 7.30 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.02 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|