C36H36Cl3NO8S — CID 102166994
[(3S,4S,5R,6R)-6-(benzylsulfonyloxymethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl] 2,2,2-trichloroethanimidate (PubChem CID 102166994) has the molecular formula C36H36Cl3NO8S and a molecular weight of 749.11 g/mol. Its IUPAC name is [(3S,4S,5R,6R)-6-(benzylsulfonyloxymethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [(3S,4S,5R,6R)-6-(benzylsulfonyloxymethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 102166994 |
| Molecular Formula | C36H36Cl3NO8S |
| Molecular Weight | 749.11 g/mol |
| Exact Mass | 747.12 |
| IUPAC Name | [(3S,4S,5R,6R)-6-(benzylsulfonyloxymethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OC1O[C@H](COS(=O)(=O)Cc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C36H36Cl3NO8S/c37-36(38,39)35(40)48-34-33(45-23-28-17-9-3-10-18-28)32(44-22-27-15-7-2-8-16-27)31(43-21-26-13-5-1-6-14-26)30(47-34)24-46-49(41,42)25-29-19-11-4-12-20-29/h1-20,30-34,40H,21-25H2/b40-35+/t30-,31-,32+,33+,34?/m1/s1 |
| InChIKey | KNPTVZGLMALGBV-RCNMJXLSSA-N |
| XLogP | 7.38 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.11 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|