C29H29Cl3N4O5 — CID 102456606
[(2R,3R,4S,5R,6R)-6-(azidomethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl] 2,2,2-trichloroethanimidate (PubChem CID 102456606) has the molecular formula C29H29Cl3N4O5 and a molecular weight of 619.93 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-6-(azidomethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [(2R,3R,4S,5R,6R)-6-(azidomethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 102456606 |
| Molecular Formula | C29H29Cl3N4O5 |
| Molecular Weight | 619.93 g/mol |
| Exact Mass | 618.12 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-6-(azidomethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/O[C@H]1O[C@H](CN=[N+]=[N-])[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C29H29Cl3N4O5/c30-29(31,32)28(33)41-27-26(39-19-22-14-8-3-9-15-22)25(38-18-21-12-6-2-7-13-21)24(23(40-27)16-35-36-34)37-17-20-10-4-1-5-11-20/h1-15,23-27,33H,16-19H2/b33-28+/t23-,24-,25+,26-,27-/m1/s1 |
| InChIKey | ZRBHTXVPVIYBRI-AKAKWTELSA-N |
| XLogP | 7.14 |
| TPSA | 118.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.93 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|