C15H16Cl3N7O3 — CID 102078124
[(2R,3R,4S,5R,6R)-3,5-diazido-6-methyl-4-phenylmethoxyoxan-2-yl] 2,2,2-trichloroethanimidate (PubChem CID 102078124) has the molecular formula C15H16Cl3N7O3 and a molecular weight of 448.70 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,5-diazido-6-methyl-4-phenylmethoxyoxan-2-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,5-diazido-6-methyl-4-phenylmethoxyoxan-2-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 102078124 |
| Molecular Formula | C15H16Cl3N7O3 |
| Molecular Weight | 448.70 g/mol |
| Exact Mass | 447.04 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,5-diazido-6-methyl-4-phenylmethoxyoxan-2-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/O[C@H]1O[C@H](C)[C@@H](N=[N+]=[N-])[C@H](OCc2ccccc2)[C@H]1N=[N+]=[N-])C(Cl)(Cl)Cl |
| InChI | InChI=1S/C15H16Cl3N7O3/c1-8-10(22-24-20)12(26-7-9-5-3-2-4-6-9)11(23-25-21)13(27-8)28-14(19)15(16,17)18/h2-6,8,10-13,19H,7H2,1H3/b19-14+/t8-,10-,11-,12+,13-/m1/s1 |
| InChIKey | IVBACYMXYCCWDT-NIQNGIFWSA-N |
| XLogP | 5.04 |
| TPSA | 149.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.70 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|