C23H23Cl3N4O6 — CID 11364976
[(2R,4aR,6R,7R,8R,8aS)-7-azido-8-[(4-methoxyphenyl)methoxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] 2,2,2-trichloroethanimidate (PubChem CID 11364976) has the molecular formula C23H23Cl3N4O6 and a molecular weight of 557.82 g/mol. Its IUPAC name is [(2R,4aR,6R,7R,8R,8aS)-7-azido-8-[(4-methoxyphenyl)methoxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [(2R,4aR,6R,7R,8R,8aS)-7-azido-8-[(4-methoxyphenyl)methoxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 11364976 |
| Molecular Formula | C23H23Cl3N4O6 |
| Molecular Weight | 557.82 g/mol |
| Exact Mass | 556.07 |
| IUPAC Name | [(2R,4aR,6R,7R,8R,8aS)-7-azido-8-[(4-methoxyphenyl)methoxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/O[C@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@H](OCc2ccc(OC)cc2)[C@H]1N=[N+]=[N-])C(Cl)(Cl)Cl |
| InChI | InChI=1S/C23H23Cl3N4O6/c1-31-15-9-7-13(8-10-15)11-32-19-17(29-30-28)21(36-22(27)23(24,25)26)34-16-12-33-20(35-18(16)19)14-5-3-2-4-6-14/h2-10,16-21,27H,11-12H2,1H3/b27-22+/t16-,17-,18-,19-,20-,21-/m1/s1 |
| InChIKey | SSBSZYZUXGHBGE-BBLGBPCGSA-N |
| XLogP | 5.46 |
| TPSA | 127.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.82 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|