C29H32O7 — CID 59269860
(6R,8S,8aS)-6-methoxy-7-[(4-methoxyphenyl)methoxy]-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 59269860) has the molecular formula C29H32O7 and a molecular weight of 492.57 g/mol. Its IUPAC name is (6R,8S,8aS)-6-methoxy-7-[(4-methoxyphenyl)methoxy]-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (6R,8S,8aS)-6-methoxy-7-[(4-methoxyphenyl)methoxy]-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 59269860 |
| Molecular Formula | C29H32O7 |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | (6R,8S,8aS)-6-methoxy-7-[(4-methoxyphenyl)methoxy]-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | COc1ccc(COC2[C@H](OC)OC3COC(c4ccccc4)O[C@@H]3[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C29H32O7/c1-30-23-15-13-21(14-16-23)18-33-27-26(32-17-20-9-5-3-6-10-20)25-24(35-29(27)31-2)19-34-28(36-25)22-11-7-4-8-12-22/h3-16,24-29H,17-19H2,1-2H3/t24?,25-,26-,27?,28?,29+/m0/s1 |
| InChIKey | VSPSIRKZFTWXDX-KUZYCWJNSA-N |
| XLogP | 4.65 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |